C24H22F3N7O — CID 162722118
3,3-difluoroprop-1-en-2-yl 4-[[4-[2-(ethylamino)quinazolin-6-yl]triazol-1-yl]methyl]-2-fluoro-N-methylbenzenecarboximidate (PubChem CID 162722118) has the molecular formula C24H22F3N7O and a molecular weight of 481.48 g/mol. Its IUPAC name is 3,3-difluoroprop-1-en-2-yl 4-[[4-[2-(ethylamino)quinazolin-6-yl]triazol-1-yl]methyl]-2-fluoro-N-methylbenzenecarboximidate.
| Compound Name | 3,3-difluoroprop-1-en-2-yl 4-[[4-[2-(ethylamino)quinazolin-6-yl]triazol-1-yl]methyl]-2-fluoro-N-methylbenzenecarboximidate |
|---|---|
| PubChem CID | 162722118 |
| Molecular Formula | C24H22F3N7O |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 3,3-difluoroprop-1-en-2-yl 4-[[4-[2-(ethylamino)quinazolin-6-yl]triazol-1-yl]methyl]-2-fluoro-N-methylbenzenecarboximidate |
| SMILES | C=C(O/C(=N\C)c1ccc(Cn2cc(-c3ccc4nc(NCC)ncc4c3)nn2)cc1F)C(F)F |
| InChI | InChI=1S/C24H22F3N7O/c1-4-29-24-30-11-17-10-16(6-8-20(17)31-24)21-13-34(33-32-21)12-15-5-7-18(19(25)9-15)23(28-3)35-14(2)22(26)27/h5-11,13,22H,2,4,12H2,1,3H3,(H,29,30,31)/b28-23- |
| InChIKey | KVMMAMISTYXACI-NFFVHWSESA-N |
| XLogP | 4.68 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|