C9H4B2BrF2N3O — CID 162722400
CID 162722400 (PubChem CID 162722400) has the molecular formula C9H4B2BrF2N3O and a molecular weight of 309.68 g/mol.
| Compound Name | CID 162722400 |
|---|---|
| PubChem CID | 162722400 |
| Molecular Formula | C9H4B2BrF2N3O |
| Molecular Weight | 309.68 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | — |
| SMILES | [B]C([B])(Br)c1ccc(-c2nnc(C(F)F)o2)cn1 |
| InChI | InChI=1S/C9H4B2BrF2N3O/c10-9(11,12)5-2-1-4(3-15-5)7-16-17-8(18-7)6(13)14/h1-3,6H |
| InChIKey | XPKIQQUYLUKRLL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.68 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|