C23H18F4N6O4 — CID 162722474
N-[3-[3-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2,6-difluorophenyl]methyl]-1,2,4-oxadiazol-5-yl]phenyl]morpholine-4-carboxamide (PubChem CID 162722474) has the molecular formula C23H18F4N6O4 and a molecular weight of 518.43 g/mol. Its IUPAC name is N-[3-[3-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2,6-difluorophenyl]methyl]-1,2,4-oxadiazol-5-yl]phenyl]morpholine-4-carboxamide.
| Compound Name | N-[3-[3-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2,6-difluorophenyl]methyl]-1,2,4-oxadiazol-5-yl]phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 162722474 |
| Molecular Formula | C23H18F4N6O4 |
| Molecular Weight | 518.43 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | N-[3-[3-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2,6-difluorophenyl]methyl]-1,2,4-oxadiazol-5-yl]phenyl]morpholine-4-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nc(Cc3c(F)cc(-c4nnc(C(F)F)o4)cc3F)no2)c1)N1CCOCC1 |
| InChI | InChI=1S/C23H18F4N6O4/c24-16-9-13(21-30-31-22(36-21)19(26)27)10-17(25)15(16)11-18-29-20(37-32-18)12-2-1-3-14(8-12)28-23(34)33-4-6-35-7-5-33/h1-3,8-10,19H,4-7,11H2,(H,28,34) |
| InChIKey | BLKADRLYCZBTPT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |