C18H13F2N5O2 — CID 162722551
4-[5-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 162722551) has the molecular formula C18H13F2N5O2 and a molecular weight of 369.33 g/mol. Its IUPAC name is 4-[5-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 4-[5-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 162722551 |
| Molecular Formula | C18H13F2N5O2 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-[5-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | Nc1ccc(-c2noc(Cc3ccc(-c4nnc(C(F)F)o4)cc3)n2)cc1 |
| InChI | InChI=1S/C18H13F2N5O2/c19-15(20)18-24-23-17(26-18)12-3-1-10(2-4-12)9-14-22-16(25-27-14)11-5-7-13(21)8-6-11/h1-8,15H,9,21H2 |
| InChIKey | FTLFKXHVPHNLOV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|