C11H12F2N2O — CID 162722599
2-(difluoromethyl)-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3,4-oxadiazole (PubChem CID 162722599) has the molecular formula C11H12F2N2O and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3,4-oxadiazole.
| Compound Name | 2-(difluoromethyl)-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 162722599 |
| Molecular Formula | C11H12F2N2O |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-(difluoromethyl)-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3,4-oxadiazole |
| SMILES | C=C/C(=C\C=C(C)C)c1nnc(C(F)F)o1 |
| InChI | InChI=1S/C11H12F2N2O/c1-4-8(6-5-7(2)3)10-14-15-11(16-10)9(12)13/h4-6,9H,1H2,2-3H3/b8-6+ |
| InChIKey | GPSQHZKVIFMXOH-SOFGYWHQSA-N |
| XLogP | 3.54 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|