C17H17F2N7O2 — CID 162722634
3-amino-N'-[amino-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]amino]-4-hydroxybenzenecarboximidamide (PubChem CID 162722634) has the molecular formula C17H17F2N7O2 and a molecular weight of 389.37 g/mol. Its IUPAC name is 3-amino-N'-[amino-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]amino]-4-hydroxybenzenecarboximidamide.
| Compound Name | 3-amino-N'-[amino-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]amino]-4-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 162722634 |
| Molecular Formula | C17H17F2N7O2 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-amino-N'-[amino-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]amino]-4-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\N(N)Cc1ccc(-c2nnc(C(F)F)o2)cc1)c1ccc(O)c(N)c1 |
| InChI | InChI=1S/C17H17F2N7O2/c18-14(19)17-24-23-16(28-17)10-3-1-9(2-4-10)8-26(22)25-15(21)11-5-6-13(27)12(20)7-11/h1-7,14,27H,8,20,22H2,(H2,21,25) |
| InChIKey | YNHQTENMRAQGOY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|