C24H30N4O2 — CID 162722819
4,8-dimethyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one;7-methylspiro[1,4-dihydroquinoxaline-3,1'-cyclopentane]-2-one (PubChem CID 162722819) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4,8-dimethyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one;7-methylspiro[1,4-dihydroquinoxaline-3,1'-cyclopentane]-2-one.
| Compound Name | 4,8-dimethyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one;7-methylspiro[1,4-dihydroquinoxaline-3,1'-cyclopentane]-2-one |
|---|---|
| PubChem CID | 162722819 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 4,8-dimethyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one;7-methylspiro[1,4-dihydroquinoxaline-3,1'-cyclopentane]-2-one |
| SMILES | Cc1ccc2c(c1)NC(=O)C1(CCCC1)N2.Cc1ccc2c(c1)NC(=O)CN(C)C2 |
| InChI | InChI=1S/C13H16N2O.C11H14N2O/c1-9-4-5-10-11(8-9)14-12(16)13(15-10)6-2-3-7-13;1-8-3-4-9-6-13(2)7-11(14)12-10(9)5-8/h4-5,8,15H,2-3,6-7H2,1H3,(H,14,16);3-5H,6-7H2,1-2H3,(H,12,14) |
| InChIKey | HWINGMPZKQETOH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |