C21H18F2N6OS — CID 162722888
1-[6-[[4-(2-amino-1,3-benzothiazol-6-yl)pyrazol-1-yl]methyl]-3-pyridinyl]ethenyl 2,2-difluoro-N-methylethanimidate (PubChem CID 162722888) has the molecular formula C21H18F2N6OS and a molecular weight of 440.48 g/mol. Its IUPAC name is 1-[6-[[4-(2-amino-1,3-benzothiazol-6-yl)pyrazol-1-yl]methyl]-3-pyridinyl]ethenyl 2,2-difluoro-N-methylethanimidate.
| Compound Name | 1-[6-[[4-(2-amino-1,3-benzothiazol-6-yl)pyrazol-1-yl]methyl]-3-pyridinyl]ethenyl 2,2-difluoro-N-methylethanimidate |
|---|---|
| PubChem CID | 162722888 |
| Molecular Formula | C21H18F2N6OS |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 1-[6-[[4-(2-amino-1,3-benzothiazol-6-yl)pyrazol-1-yl]methyl]-3-pyridinyl]ethenyl 2,2-difluoro-N-methylethanimidate |
| SMILES | C=C(O/C(=N/C)C(F)F)c1ccc(Cn2cc(-c3ccc4nc(N)sc4c3)cn2)nc1 |
| InChI | InChI=1S/C21H18F2N6OS/c1-12(30-20(25-2)19(22)23)14-3-5-16(26-8-14)11-29-10-15(9-27-29)13-4-6-17-18(7-13)31-21(24)28-17/h3-10,19H,1,11H2,2H3,(H2,24,28)/b25-20+ |
| InChIKey | GRWYLZLZWIQTAZ-LKUDQCMESA-N |
| XLogP | 4.47 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|