C20H31F3N6 — CID 162723820
5-methylpyrazolo[1,5-a]pyrimidine;piperidine-1-carboximidamide;trifluoromethylcyclohexane (PubChem CID 162723820) has the molecular formula C20H31F3N6 and a molecular weight of 412.50 g/mol. Its IUPAC name is 5-methylpyrazolo[1,5-a]pyrimidine;piperidine-1-carboximidamide;trifluoromethylcyclohexane.
| Compound Name | 5-methylpyrazolo[1,5-a]pyrimidine;piperidine-1-carboximidamide;trifluoromethylcyclohexane |
|---|---|
| PubChem CID | 162723820 |
| Molecular Formula | C20H31F3N6 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 5-methylpyrazolo[1,5-a]pyrimidine;piperidine-1-carboximidamide;trifluoromethylcyclohexane |
| SMILES | Cc1ccn2nccc2n1.FC(F)(F)C1CCCCC1.[H]/N=C(\N)N1CCCCC1 |
| InChI | InChI=1S/C7H11F3.C7H7N3.C6H13N3/c8-7(9,10)6-4-2-1-3-5-6;1-6-3-5-10-7(9-6)2-4-8-10;7-6(8)9-4-2-1-3-5-9/h6H,1-5H2;2-5H,1H3;1-5H2,(H3,7,8) |
| InChIKey | FEQAYHHUGUYRJA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|