About 2-amino-5,5-dimethylcycloheptan-1-ol;ethane
2-amino-5,5-dimethylcycloheptan-1-ol;ethane (PubChem CID 162724462) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is 2-amino-5,5-dimethylcycloheptan-1-ol;ethane.
Molecular Properties
| Compound Name | 2-amino-5,5-dimethylcycloheptan-1-ol;ethane |
| PubChem CID | 162724462 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 2-amino-5,5-dimethylcycloheptan-1-ol;ethane |
| SMILES | CC.CC1(C)CCC(N)C(O)CC1 |
| InChI | InChI=1S/C9H19NO.C2H6/c1-9(2)5-3-7(10)8(11)4-6-9;1-2/h7-8,11H,3-6,10H2,1-2H3;1-2H3 |
| InChIKey | JDUHYQQZTQVURM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-5,5-dimethylcycloheptan-1-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5,5-dimethylcycloheptan-1-ol;ethane?
The IUPAC name of 2-amino-5,5-dimethylcycloheptan-1-ol;ethane (CID 162724462) is 2-amino-5,5-dimethylcycloheptan-1-ol;ethane.
What is the SMILES notation for 2-amino-5,5-dimethylcycloheptan-1-ol;ethane?
The canonical SMILES for 2-amino-5,5-dimethylcycloheptan-1-ol;ethane is CC.CC1(C)CCC(N)C(O)CC1.
What is the InChIKey of 2-amino-5,5-dimethylcycloheptan-1-ol;ethane?
The InChIKey is JDUHYQQZTQVURM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.C2H6/c1-9(2)5-3-7(10)8(11)4-6-9;1-2/h7-8,11H,3-6,10H2,1-2H3;1-2H3.
What are the key properties of 2-amino-5,5-dimethylcycloheptan-1-ol;ethane?
2-amino-5,5-dimethylcycloheptan-1-ol;ethane has a molecular weight of 187.33 g/mol, XLogP of 2.30, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5,5-dimethylcycloheptan-1-ol;ethane is sourced from PubChem (CID 162724462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).