About (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane
(3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane (PubChem CID 162724478) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane.
Molecular Properties
| Compound Name | (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane |
| PubChem CID | 162724478 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane |
| SMILES | C=C/C=C(/O)C(=C)C(C)(C)N.CC |
| InChI | InChI=1S/C9H15NO.C2H6/c1-5-6-8(11)7(2)9(3,4)10;1-2/h5-6,11H,1-2,10H2,3-4H3;1-2H3/b8-6+; |
| InChIKey | ARXGMEQRTJKIKE-WVLIHFOGSA-N |
| XLogP | 2.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane?
The IUPAC name of (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane (CID 162724478) is (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane.
What is the SMILES notation for (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane?
The canonical SMILES for (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane is C=C/C=C(/O)C(=C)C(C)(C)N.CC.
What is the InChIKey of (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane?
The InChIKey is ARXGMEQRTJKIKE-WVLIHFOGSA-N. The full InChI is InChI=1S/C9H15NO.C2H6/c1-5-6-8(11)7(2)9(3,4)10;1-2/h5-6,11H,1-2,10H2,3-4H3;1-2H3/b8-6+;.
What are the key properties of (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane?
(3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane has a molecular weight of 183.29 g/mol, XLogP of 2.93, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-6-amino-6-methyl-5-methylidenehepta-1,3-dien-4-ol;ethane is sourced from PubChem (CID 162724478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).