About (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
(4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 162724636) has the molecular formula C19H35NO4
and a molecular weight of 341.49 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
Molecular Properties
| Compound Name | (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| PubChem CID | 162724636 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)OC1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H35NO4/c1-17(2,3)13-9-11-14(12-10-13)23-15(21)19(7,8)20-16(22)24-18(4,5)6/h13-14H,9-12H2,1-8H3,(H,20,22) |
| InChIKey | BPHREPRLCDHKNZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The IUPAC name of (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CID 162724636) is (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
What is the SMILES notation for (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The canonical SMILES for (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate is CC(C)(C)OC(=O)NC(C)(C)C(=O)OC1CCC(C(C)(C)C)CC1.
What is the InChIKey of (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
The InChIKey is BPHREPRLCDHKNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35NO4/c1-17(2,3)13-9-11-14(12-10-13)23-15(21)19(7,8)20-16(22)24-18(4,5)6/h13-14H,9-12H2,1-8H3,(H,20,22).
What are the key properties of (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate?
(4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate has a molecular weight of 341.49 g/mol, XLogP of 4.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylcyclohexyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate is sourced from PubChem (CID 162724636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).