About (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride
(2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride (PubChem CID 162724729) has the molecular formula C12H20ClF2NO2
and a molecular weight of 283.75 g/mol. Its IUPAC name is (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride |
| PubChem CID | 162724729 |
| Molecular Formula | C12H20ClF2NO2 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride |
| SMILES | CC(C)(N)C(=O)OCC1CC2(C1)CC(F)(F)C2.Cl |
| InChI | InChI=1S/C12H19F2NO2.ClH/c1-10(2,15)9(16)17-5-8-3-11(4-8)6-12(13,14)7-11;/h8H,3-7,15H2,1-2H3;1H |
| InChIKey | BPLVJSXUGPDQFD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride?
The IUPAC name of (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride (CID 162724729) is (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride.
What is the SMILES notation for (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride?
The canonical SMILES for (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride is CC(C)(N)C(=O)OCC1CC2(C1)CC(F)(F)C2.Cl.
What is the InChIKey of (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride?
The InChIKey is BPLVJSXUGPDQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2NO2.ClH/c1-10(2,15)9(16)17-5-8-3-11(4-8)6-12(13,14)7-11;/h8H,3-7,15H2,1-2H3;1H.
What are the key properties of (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride?
(2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride has a molecular weight of 283.75 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-difluorospiro[3.3]heptan-6-yl)methyl 2-amino-2-methylpropanoate;hydrochloride is sourced from PubChem (CID 162724729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).