C21H36N4O2 — CID 162725444
2-[4-[2-(tert-butylamino)acetyl]piperazin-1-yl]-N-(4-methylphenyl)acetamide;ethane (PubChem CID 162725444) has the molecular formula C21H36N4O2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 2-[4-[2-(tert-butylamino)acetyl]piperazin-1-yl]-N-(4-methylphenyl)acetamide;ethane.
| Compound Name | 2-[4-[2-(tert-butylamino)acetyl]piperazin-1-yl]-N-(4-methylphenyl)acetamide;ethane |
|---|---|
| PubChem CID | 162725444 |
| Molecular Formula | C21H36N4O2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 2-[4-[2-(tert-butylamino)acetyl]piperazin-1-yl]-N-(4-methylphenyl)acetamide;ethane |
| SMILES | CC.Cc1ccc(NC(=O)CN2CCN(C(=O)CNC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H30N4O2.C2H6/c1-15-5-7-16(8-6-15)21-17(24)14-22-9-11-23(12-10-22)18(25)13-20-19(2,3)4;1-2/h5-8,20H,9-14H2,1-4H3,(H,21,24);1-2H3 |
| InChIKey | HJSYEXRCVJBTPP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |