C16H27N3O — CID 162725478
ethane;N-(4-ethylpiperidin-4-yl)-3-methylpyridine-2-carboxamide (PubChem CID 162725478) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is ethane;N-(4-ethylpiperidin-4-yl)-3-methylpyridine-2-carboxamide.
| Compound Name | ethane;N-(4-ethylpiperidin-4-yl)-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 162725478 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | ethane;N-(4-ethylpiperidin-4-yl)-3-methylpyridine-2-carboxamide |
| SMILES | CC.CCC1(NC(=O)c2ncccc2C)CCNCC1 |
| InChI | InChI=1S/C14H21N3O.C2H6/c1-3-14(6-9-15-10-7-14)17-13(18)12-11(2)5-4-8-16-12;1-2/h4-5,8,15H,3,6-7,9-10H2,1-2H3,(H,17,18);1-2H3 |
| InChIKey | BCEDUGBZEDMAEP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |