C11H19NO — CID 162725811
4-[4-(methylamino)butan-2-yl]cyclohexa-1,3-dien-1-ol (PubChem CID 162725811) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-[4-(methylamino)butan-2-yl]cyclohexa-1,3-dien-1-ol.
| Compound Name | 4-[4-(methylamino)butan-2-yl]cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 162725811 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-[4-(methylamino)butan-2-yl]cyclohexa-1,3-dien-1-ol |
| SMILES | CNCCC(C)C1=CC=C(O)CC1 |
| InChI | InChI=1S/C11H19NO/c1-9(7-8-12-2)10-3-5-11(13)6-4-10/h3,5,9,12-13H,4,6-8H2,1-2H3 |
| InChIKey | GIDNDIBVLVNMPQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |