About 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride
1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride (PubChem CID 162726350) has the molecular formula C10H19ClF2N2O
and a molecular weight of 256.72 g/mol. Its IUPAC name is 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride |
| PubChem CID | 162726350 |
| Molecular Formula | C10H19ClF2N2O |
| Molecular Weight | 256.72 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride |
| SMILES | Cl.OC1CCN(C2CCNCC2(F)F)CC1 |
| InChI | InChI=1S/C10H18F2N2O.ClH/c11-10(12)7-13-4-1-9(10)14-5-2-8(15)3-6-14;/h8-9,13,15H,1-7H2;1H |
| InChIKey | PSYSLDHPIZAHCU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.72 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride?
The IUPAC name of 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride (CID 162726350) is 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride.
What is the SMILES notation for 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride?
The canonical SMILES for 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride is Cl.OC1CCN(C2CCNCC2(F)F)CC1.
What is the InChIKey of 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride?
The InChIKey is PSYSLDHPIZAHCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O.ClH/c11-10(12)7-13-4-1-9(10)14-5-2-8(15)3-6-14;/h8-9,13,15H,1-7H2;1H.
What are the key properties of 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride?
1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride has a molecular weight of 256.72 g/mol, XLogP of 0.86, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluoropiperidin-4-yl)piperidin-4-ol;hydrochloride is sourced from PubChem (CID 162726350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).