C29H32F6N4O5 — CID 162726587
tert-butyl N-[(9Z)-6-[(2E)-2-ethenylpenta-2,4-dienoxy]-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamate (PubChem CID 162726587) has the molecular formula C29H32F6N4O5 and a molecular weight of 630.59 g/mol. Its IUPAC name is tert-butyl N-[(9Z)-6-[(2E)-2-ethenylpenta-2,4-dienoxy]-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamate.
| Compound Name | tert-butyl N-[(9Z)-6-[(2E)-2-ethenylpenta-2,4-dienoxy]-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamate |
|---|---|
| PubChem CID | 162726587 |
| Molecular Formula | C29H32F6N4O5 |
| Molecular Weight | 630.59 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | tert-butyl N-[(9Z)-6-[(2E)-2-ethenylpenta-2,4-dienoxy]-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamate |
| SMILES | C=C/C=C(\C=C)COC1(C(F)(F)F)CC/C=C\CC(C)Oc2nc(c(NC(=O)OC(C)(C)C)cc2C(F)(F)F)-c2nnc1o2 |
| InChI | InChI=1S/C29H32F6N4O5/c1-7-12-18(8-2)16-41-27(29(33,34)35)14-11-9-10-13-17(3)42-22-19(28(30,31)32)15-20(36-25(40)44-26(4,5)6)21(37-22)23-38-39-24(27)43-23/h7-10,12,15,17H,1-2,11,13-14,16H2,3-6H3,(H,36,40)/b10-9-,18-12+ |
| InChIKey | YSAWHTYAYLOYHZ-RIRGNKECSA-N |
| XLogP | 8.08 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.59 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|