C22H17F5N4O5 — CID 162726601
(8E)-7,7-difluoro-17-nitro-6-phenylmethoxy-15-(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaene (PubChem CID 162726601) has the molecular formula C22H17F5N4O5 and a molecular weight of 512.39 g/mol. Its IUPAC name is (8E)-7,7-difluoro-17-nitro-6-phenylmethoxy-15-(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaene.
| Compound Name | (8E)-7,7-difluoro-17-nitro-6-phenylmethoxy-15-(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaene |
|---|---|
| PubChem CID | 162726601 |
| Molecular Formula | C22H17F5N4O5 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | (8E)-7,7-difluoro-17-nitro-6-phenylmethoxy-15-(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaene |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c2nc1-c1nnc(o1)C(OCc1ccccc1)C(F)(F)/C=C/CCCO2 |
| InChI | InChI=1S/C22H17F5N4O5/c23-21(24)9-5-2-6-10-34-18-14(22(25,26)27)11-15(31(32)33)16(28-18)19-29-30-20(36-19)17(21)35-12-13-7-3-1-4-8-13/h1,3-5,7-9,11,17H,2,6,10,12H2/b9-5+ |
| InChIKey | YBSLAUKCFTUZHQ-WEVVVXLNSA-N |
| XLogP | 5.68 |
| TPSA | 113.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|