methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate

C8H7F3NO2+ — CID 162726848

IUPACmethyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate
SMILESCOC(=O)c1ccc(C(F)(F)F)c[nH+]1
InChIInChI=1S/C8H6F3NO2/c1-14-7(13)6-3-2-5(4-12-6)8(9,10)11/h2-4H,1H3/p+1
InChIKeyCHRQADSGOKVKER-UHFFFAOYSA-O
MW206.14 g/mol
LogP1.31
Rot. Bonds1

About methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate

methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate (PubChem CID 162726848) has the molecular formula C8H7F3NO2+ and a molecular weight of 206.14 g/mol. Its IUPAC name is methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate
PubChem CID162726848
Molecular FormulaC8H7F3NO2+
Molecular Weight206.14 g/mol
Exact Mass206.04
IUPAC Namemethyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate
SMILESCOC(=O)c1ccc(C(F)(F)F)c[nH+]1
InChIInChI=1S/C8H6F3NO2/c1-14-7(13)6-3-2-5(4-12-6)8(9,10)11/h2-4H,1H3/p+1
InChIKeyCHRQADSGOKVKER-UHFFFAOYSA-O
XLogP1.31
TPSA40.44 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.14
LogP ≤ 51.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate?
The IUPAC name of methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate (CID 162726848) is methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate.
What is the SMILES notation for methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate?
The canonical SMILES for methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate is COC(=O)c1ccc(C(F)(F)F)c[nH+]1.
What is the InChIKey of methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate?
The InChIKey is CHRQADSGOKVKER-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H6F3NO2/c1-14-7(13)6-3-2-5(4-12-6)8(9,10)11/h2-4H,1H3/p+1.
What are the key properties of methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate?
methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate has a molecular weight of 206.14 g/mol, XLogP of 1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(trifluoromethyl)pyridin-1-ium-2-carboxylate is sourced from PubChem (CID 162726848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).