About 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride
1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride (PubChem CID 162726899) has the molecular formula C8H12ClNO4S2
and a molecular weight of 285.77 g/mol. Its IUPAC name is 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride |
| PubChem CID | 162726899 |
| Molecular Formula | C8H12ClNO4S2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride |
| SMILES | CN(C)S(=O)(=O)C1(S(=O)(=O)Cl)C=CC=CC1 |
| InChI | InChI=1S/C8H12ClNO4S2/c1-10(2)16(13,14)8(15(9,11)12)6-4-3-5-7-8/h3-6H,7H2,1-2H3 |
| InChIKey | WORCYOIVHFDTQJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride?
The IUPAC name of 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride (CID 162726899) is 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride.
What is the SMILES notation for 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride?
The canonical SMILES for 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride is CN(C)S(=O)(=O)C1(S(=O)(=O)Cl)C=CC=CC1.
What is the InChIKey of 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride?
The InChIKey is WORCYOIVHFDTQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClNO4S2/c1-10(2)16(13,14)8(15(9,11)12)6-4-3-5-7-8/h3-6H,7H2,1-2H3.
What are the key properties of 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride?
1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride has a molecular weight of 285.77 g/mol, XLogP of 0.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylsulfamoyl)cyclohexa-2,4-diene-1-sulfonyl chloride is sourced from PubChem (CID 162726899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).