About 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide
2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide (PubChem CID 162727349) has the molecular formula C11H14Cl2N4O2
and a molecular weight of 305.17 g/mol. Its IUPAC name is 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide.
Molecular Properties
| Compound Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide |
| PubChem CID | 162727349 |
| Molecular Formula | C11H14Cl2N4O2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide |
| SMILES | O=C(Cn1ncc(Cl)c(Cl)c1=O)NC1CCCNC1 |
| InChI | InChI=1S/C11H14Cl2N4O2/c12-8-5-15-17(11(19)10(8)13)6-9(18)16-7-2-1-3-14-4-7/h5,7,14H,1-4,6H2,(H,16,18) |
| InChIKey | AJQFPDMVIUAPMA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide?
The IUPAC name of 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide (CID 162727349) is 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide.
What is the SMILES notation for 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide?
The canonical SMILES for 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide is O=C(Cn1ncc(Cl)c(Cl)c1=O)NC1CCCNC1.
What is the InChIKey of 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide?
The InChIKey is AJQFPDMVIUAPMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2N4O2/c12-8-5-15-17(11(19)10(8)13)6-9(18)16-7-2-1-3-14-4-7/h5,7,14H,1-4,6H2,(H,16,18).
What are the key properties of 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide?
2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide has a molecular weight of 305.17 g/mol, XLogP of 0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dichloro-6-oxopyridazin-1-yl)-N-piperidin-3-ylacetamide is sourced from PubChem (CID 162727349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).