About (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid
(2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid (PubChem CID 162727494) has the molecular formula C7H6Cl2N2O3
and a molecular weight of 237.04 g/mol. Its IUPAC name is (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid |
| PubChem CID | 162727494 |
| Molecular Formula | C7H6Cl2N2O3 |
| Molecular Weight | 237.04 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid |
| SMILES | C[C@H](C(=O)O)n1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C7H6Cl2N2O3/c1-3(7(13)14)11-6(12)5(9)4(8)2-10-11/h2-3H,1H3,(H,13,14)/t3-/m1/s1 |
| InChIKey | VZYHSYUOVLQQCJ-GSVOUGTGSA-N |
| XLogP | 1.20 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.04 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid?
The IUPAC name of (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid (CID 162727494) is (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid.
What is the SMILES notation for (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid?
The canonical SMILES for (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid is C[C@H](C(=O)O)n1ncc(Cl)c(Cl)c1=O.
What is the InChIKey of (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid?
The InChIKey is VZYHSYUOVLQQCJ-GSVOUGTGSA-N. The full InChI is InChI=1S/C7H6Cl2N2O3/c1-3(7(13)14)11-6(12)5(9)4(8)2-10-11/h2-3H,1H3,(H,13,14)/t3-/m1/s1.
What are the key properties of (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid?
(2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid has a molecular weight of 237.04 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4,5-dichloro-6-oxopyridazin-1-yl)propanoic acid is sourced from PubChem (CID 162727494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).