About 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide
3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide (PubChem CID 162727988) has the molecular formula C9H11FN2O4S
and a molecular weight of 262.26 g/mol. Its IUPAC name is 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide.
Molecular Properties
| Compound Name | 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide |
| PubChem CID | 162727988 |
| Molecular Formula | C9H11FN2O4S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1c(F)cc([N+](=O)[O-])cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C9H11FN2O4S/c1-6-8(10)4-7(12(13)14)5-9(6)17(15,16)11(2)3/h4-5H,1-3H3 |
| InChIKey | FMVOSUBSTRZMIF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide?
The IUPAC name of 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide (CID 162727988) is 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide.
What is the SMILES notation for 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide?
The canonical SMILES for 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide is Cc1c(F)cc([N+](=O)[O-])cc1S(=O)(=O)N(C)C.
What is the InChIKey of 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide?
The InChIKey is FMVOSUBSTRZMIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O4S/c1-6-8(10)4-7(12(13)14)5-9(6)17(15,16)11(2)3/h4-5H,1-3H3.
What are the key properties of 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide?
3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide has a molecular weight of 262.26 g/mol, XLogP of 1.29, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N,N,2-trimethyl-5-nitrobenzenesulfonamide is sourced from PubChem (CID 162727988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).