C8H11N3O2S — CID 162728106
1,1-dioxo-2,3,4,5-tetrahydro-1λ6,2,5-benzothiadiazepin-8-amine (PubChem CID 162728106) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 1,1-dioxo-2,3,4,5-tetrahydro-1λ6,2,5-benzothiadiazepin-8-amine.
| Compound Name | 1,1-dioxo-2,3,4,5-tetrahydro-1λ6,2,5-benzothiadiazepin-8-amine |
|---|---|
| PubChem CID | 162728106 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1,1-dioxo-2,3,4,5-tetrahydro-1λ6,2,5-benzothiadiazepin-8-amine |
| SMILES | Nc1ccc2c(c1)S(=O)(=O)NCCN2 |
| InChI | InChI=1S/C8H11N3O2S/c9-6-1-2-7-8(5-6)14(12,13)11-4-3-10-7/h1-2,5,10-11H,3-4,9H2 |
| InChIKey | HLMKOPUBTOULQU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|