C12H13F2NO3 — CID 162728759
4-(difluoromethyl)-1-oxidospiro[5,6-dihydropyrano[3,4-b]pyridin-1-ium-8,3'-oxolane] (PubChem CID 162728759) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is 4-(difluoromethyl)-1-oxidospiro[5,6-dihydropyrano[3,4-b]pyridin-1-ium-8,3'-oxolane].
| Compound Name | 4-(difluoromethyl)-1-oxidospiro[5,6-dihydropyrano[3,4-b]pyridin-1-ium-8,3'-oxolane] |
|---|---|
| PubChem CID | 162728759 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-(difluoromethyl)-1-oxidospiro[5,6-dihydropyrano[3,4-b]pyridin-1-ium-8,3'-oxolane] |
| SMILES | [O-][n+]1ccc(C(F)F)c2c1C1(CCOC1)OCC2 |
| InChI | InChI=1S/C12H13F2NO3/c13-11(14)9-1-4-15(16)10-8(9)2-5-18-12(10)3-6-17-7-12/h1,4,11H,2-3,5-7H2 |
| InChIKey | HHKBVSSUDLBIED-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|