C11H11F2NO3 — CID 162728794
5,5-difluoro-1-oxidospiro[6H-pyrano[3,4-b]pyridin-1-ium-8,3'-oxolane] (PubChem CID 162728794) has the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. Its IUPAC name is 5,5-difluoro-1-oxidospiro[6H-pyrano[3,4-b]pyridin-1-ium-8,3'-oxolane].
| Compound Name | 5,5-difluoro-1-oxidospiro[6H-pyrano[3,4-b]pyridin-1-ium-8,3'-oxolane] |
|---|---|
| PubChem CID | 162728794 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 5,5-difluoro-1-oxidospiro[6H-pyrano[3,4-b]pyridin-1-ium-8,3'-oxolane] |
| SMILES | [O-][n+]1cccc2c1C1(CCOC1)OCC2(F)F |
| InChI | InChI=1S/C11H11F2NO3/c12-11(13)7-17-10(3-5-16-6-10)9-8(11)2-1-4-14(9)15/h1-2,4H,3,5-7H2 |
| InChIKey | XMBGCTSNVWESIH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|