About (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine
(Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine (PubChem CID 162729112) has the molecular formula C8H13FN2
and a molecular weight of 156.20 g/mol. Its IUPAC name is (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine.
Molecular Properties
| Compound Name | (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine |
| PubChem CID | 162729112 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine |
| SMILES | CC/C(N)=C/C1=NCCC1F |
| InChI | InChI=1S/C8H13FN2/c1-2-6(10)5-8-7(9)3-4-11-8/h5,7H,2-4,10H2,1H3/b6-5- |
| InChIKey | ULNSMMMHGSZVRU-WAYWQWQTSA-N |
| XLogP | 1.42 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine?
The IUPAC name of (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine (CID 162729112) is (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine.
What is the SMILES notation for (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine?
The canonical SMILES for (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine is CC/C(N)=C/C1=NCCC1F.
What is the InChIKey of (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine?
The InChIKey is ULNSMMMHGSZVRU-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H13FN2/c1-2-6(10)5-8-7(9)3-4-11-8/h5,7H,2-4,10H2,1H3/b6-5-.
What are the key properties of (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine?
(Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine has a molecular weight of 156.20 g/mol, XLogP of 1.42, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(4-fluoro-3,4-dihydro-2H-pyrrol-5-yl)but-1-en-2-amine is sourced from PubChem (CID 162729112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).