About (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine
(2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine (PubChem CID 162729153) has the molecular formula C13H22FN
and a molecular weight of 211.32 g/mol. Its IUPAC name is (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine.
Molecular Properties
| Compound Name | (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine |
| PubChem CID | 162729153 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine |
| SMILES | C=C/C(=C1/C(F)CCCN1C)C(C)(C)C |
| InChI | InChI=1S/C13H22FN/c1-6-10(13(2,3)4)12-11(14)8-7-9-15(12)5/h6,11H,1,7-9H2,2-5H3/b12-10+ |
| InChIKey | LRXZVOIAEMDGPY-ZRDIBKRKSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine?
The IUPAC name of (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine (CID 162729153) is (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine.
What is the SMILES notation for (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine?
The canonical SMILES for (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine is C=C/C(=C1/C(F)CCCN1C)C(C)(C)C.
What is the InChIKey of (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine?
The InChIKey is LRXZVOIAEMDGPY-ZRDIBKRKSA-N. The full InChI is InChI=1S/C13H22FN/c1-6-10(13(2,3)4)12-11(14)8-7-9-15(12)5/h6,11H,1,7-9H2,2-5H3/b12-10+.
What are the key properties of (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine?
(2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine has a molecular weight of 211.32 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(4,4-dimethylpent-1-en-3-ylidene)-3-fluoro-1-methylpiperidine is sourced from PubChem (CID 162729153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).