C13H13F3N5+ — CID 162729603
3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propanenitrile;1,1,1-trifluoroethane (PubChem CID 162729603) has the molecular formula C13H13F3N5+ and a molecular weight of 296.28 g/mol. Its IUPAC name is 3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propanenitrile;1,1,1-trifluoroethane.
| Compound Name | 3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propanenitrile;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 162729603 |
| Molecular Formula | C13H13F3N5+ |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propanenitrile;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.N#CCC[n+]1ccc(-c2ncccn2)cn1 |
| InChI | InChI=1S/C11H10N5.C2H3F3/c12-4-1-7-16-8-3-10(9-15-16)11-13-5-2-6-14-11;1-2(3,4)5/h2-3,5-6,8-9H,1,7H2;1H3/q+1; |
| InChIKey | XCCBUSSGFOMGDR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|