C19H32F2N6O2 — CID 162729758
(Z)-2-[amino(methyl)amino]-1-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-1-ene-1,3-diamine;methyl acetate (PubChem CID 162729758) has the molecular formula C19H32F2N6O2 and a molecular weight of 414.50 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-1-ene-1,3-diamine;methyl acetate.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-1-ene-1,3-diamine;methyl acetate |
|---|---|
| PubChem CID | 162729758 |
| Molecular Formula | C19H32F2N6O2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-1-ene-1,3-diamine;methyl acetate |
| SMILES | CCc1nc(/C(N)=C(\CN)N(C)N)ccc1N1CCCC(F)(F)C1.COC(C)=O |
| InChI | InChI=1S/C16H26F2N6.C3H6O2/c1-3-11-13(24-8-4-7-16(17,18)10-24)6-5-12(22-11)15(20)14(9-19)23(2)21;1-3(4)5-2/h5-6H,3-4,7-10,19-21H2,1-2H3;1-2H3/b15-14-; |
| InChIKey | IMKDGLNTQBJOSR-BGWNKZQTSA-N |
| XLogP | 1.45 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|