C24H35F3N6O — CID 162729784
(Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-piperidin-1-yl-6-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal (PubChem CID 162729784) has the molecular formula C24H35F3N6O and a molecular weight of 480.58 g/mol. Its IUPAC name is (Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-piperidin-1-yl-6-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal.
| Compound Name | (Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-piperidin-1-yl-6-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal |
|---|---|
| PubChem CID | 162729784 |
| Molecular Formula | C24H35F3N6O |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | (Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-piperidin-1-yl-6-(trifluoromethyl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal |
| SMILES | CCCC(/C=C\C=O)=C/N(C)C/C(=C(/N)c1ccc(N2CCCCC2)c(C(F)(F)F)n1)N(C)N |
| InChI | InChI=1S/C24H35F3N6O/c1-4-9-18(10-8-15-34)16-31(2)17-21(32(3)29)22(28)19-11-12-20(23(30-19)24(25,26)27)33-13-6-5-7-14-33/h8,10-12,15-16H,4-7,9,13-14,17,28-29H2,1-3H3/b10-8-,18-16-,22-21- |
| InChIKey | AWIPYIRSIYIEPB-CYFFLENZSA-N |
| XLogP | 3.89 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|