C28H47FN6O3 — CID 162729821
acetaldehyde;(Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[6-ethyl-5-(3-fluoropiperidin-1-yl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal;methanol (PubChem CID 162729821) has the molecular formula C28H47FN6O3 and a molecular weight of 534.72 g/mol. Its IUPAC name is acetaldehyde;(Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[6-ethyl-5-(3-fluoropiperidin-1-yl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal;methanol.
| Compound Name | acetaldehyde;(Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[6-ethyl-5-(3-fluoropiperidin-1-yl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal;methanol |
|---|---|
| PubChem CID | 162729821 |
| Molecular Formula | C28H47FN6O3 |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | acetaldehyde;(Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[6-ethyl-5-(3-fluoropiperidin-1-yl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal;methanol |
| SMILES | CC=O.CCCC(/C=C\C=O)=C/N(C)C/C(=C(/N)c1ccc(N2CCCC(F)C2)c(CC)n1)N(C)N.CO |
| InChI | InChI=1S/C25H39FN6O.C2H4O.CH4O/c1-5-9-19(10-8-15-33)16-30(3)18-24(31(4)28)25(27)22-12-13-23(21(6-2)29-22)32-14-7-11-20(26)17-32;1-2-3;1-2/h8,10,12-13,15-16,20H,5-7,9,11,14,17-18,27-28H2,1-4H3;2H,1H3;2H,1H3/b10-8-,19-16-,25-24-;; |
| InChIKey | NOPYLNDSVSHURL-MQFVTIGHSA-N |
| XLogP | 3.20 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|