C25H39FN6O — CID 162729822
(Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[6-ethyl-5-(3-fluoropiperidin-1-yl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal (PubChem CID 162729822) has the molecular formula C25H39FN6O and a molecular weight of 458.63 g/mol. Its IUPAC name is (Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[6-ethyl-5-(3-fluoropiperidin-1-yl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal.
| Compound Name | (Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[6-ethyl-5-(3-fluoropiperidin-1-yl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal |
|---|---|
| PubChem CID | 162729822 |
| Molecular Formula | C25H39FN6O |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | (Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[6-ethyl-5-(3-fluoropiperidin-1-yl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]hept-2-enal |
| SMILES | CCCC(/C=C\C=O)=C/N(C)C/C(=C(/N)c1ccc(N2CCCC(F)C2)c(CC)n1)N(C)N |
| InChI | InChI=1S/C25H39FN6O/c1-5-9-19(10-8-15-33)16-30(3)18-24(31(4)28)25(27)22-12-13-23(21(6-2)29-22)32-14-7-11-20(26)17-32/h8,10,12-13,15-16,20H,5-7,9,11,14,17-18,27-28H2,1-4H3/b10-8-,19-16-,25-24- |
| InChIKey | XWNLRQTYZJJWQJ-AABUHANASA-N |
| XLogP | 3.39 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|