C27H43F2N7O4 — CID 162729917
3-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-2-enoxy]-1-methyl-5-propylpyrazin-2-one;ethane;formic acid (PubChem CID 162729917) has the molecular formula C27H43F2N7O4 and a molecular weight of 567.68 g/mol. Its IUPAC name is 3-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-2-enoxy]-1-methyl-5-propylpyrazin-2-one;ethane;formic acid.
| Compound Name | 3-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-2-enoxy]-1-methyl-5-propylpyrazin-2-one;ethane;formic acid |
|---|---|
| PubChem CID | 162729917 |
| Molecular Formula | C27H43F2N7O4 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | 3-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3,3-difluoropiperidin-1-yl)-6-ethyl-2-pyridinyl]prop-2-enoxy]-1-methyl-5-propylpyrazin-2-one;ethane;formic acid |
| SMILES | CC.CCCc1cn(C)c(=O)c(OC/C(=C(/N)c2ccc(N3CCCC(F)(F)C3)c(CC)n2)N(C)N)n1.O=CO |
| InChI | InChI=1S/C24H35F2N7O2.C2H6.CH2O2/c1-5-8-16-13-31(3)23(34)22(29-16)35-14-20(32(4)28)21(27)18-9-10-19(17(6-2)30-18)33-12-7-11-24(25,26)15-33;1-2;2-1-3/h9-10,13H,5-8,11-12,14-15,27-28H2,1-4H3;1-2H3;1H,(H,2,3)/b21-20-;; |
| InChIKey | ZGFXLYQZXLMQKA-GPLQZYLBSA-N |
| XLogP | 3.16 |
| TPSA | 152.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|