C27H43FN6O — CID 162730170
(Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[6-ethyl-5-(3-fluoropiperidin-1-yl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]non-2-enal (PubChem CID 162730170) has the molecular formula C27H43FN6O and a molecular weight of 486.68 g/mol. Its IUPAC name is (Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[6-ethyl-5-(3-fluoropiperidin-1-yl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]non-2-enal.
| Compound Name | (Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[6-ethyl-5-(3-fluoropiperidin-1-yl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]non-2-enal |
|---|---|
| PubChem CID | 162730170 |
| Molecular Formula | C27H43FN6O |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | (Z,4Z)-4-[[[(Z)-3-amino-2-[amino(methyl)amino]-3-[6-ethyl-5-(3-fluoropiperidin-1-yl)-2-pyridinyl]prop-2-enyl]-methylamino]methylidene]non-2-enal |
| SMILES | CCCCCC(/C=C\C=O)=C/N(C)C/C(=C(/N)c1ccc(N2CCCC(F)C2)c(CC)n1)N(C)N |
| InChI | InChI=1S/C27H43FN6O/c1-5-7-8-11-21(12-10-17-35)18-32(3)20-26(33(4)30)27(29)24-14-15-25(23(6-2)31-24)34-16-9-13-22(28)19-34/h10,12,14-15,17-18,22H,5-9,11,13,16,19-20,29-30H2,1-4H3/b12-10-,21-18-,27-26- |
| InChIKey | QPPBVCKSOHQMRZ-KINGZOEGSA-N |
| XLogP | 4.17 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|