C20H33F2N5O3 — CID 162730260
1-[[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-hydroxyprop-1-enyl]-2-ethyl-3-pyridinyl]methyl]-5,5-difluoropiperidine-3-carbaldehyde;methoxymethane (PubChem CID 162730260) has the molecular formula C20H33F2N5O3 and a molecular weight of 429.51 g/mol. Its IUPAC name is 1-[[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-hydroxyprop-1-enyl]-2-ethyl-3-pyridinyl]methyl]-5,5-difluoropiperidine-3-carbaldehyde;methoxymethane.
| Compound Name | 1-[[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-hydroxyprop-1-enyl]-2-ethyl-3-pyridinyl]methyl]-5,5-difluoropiperidine-3-carbaldehyde;methoxymethane |
|---|---|
| PubChem CID | 162730260 |
| Molecular Formula | C20H33F2N5O3 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 1-[[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-hydroxyprop-1-enyl]-2-ethyl-3-pyridinyl]methyl]-5,5-difluoropiperidine-3-carbaldehyde;methoxymethane |
| SMILES | CCc1nc(/C(N)=C(\CO)N(C)N)ccc1CN1CC(C=O)CC(F)(F)C1.COC |
| InChI | InChI=1S/C18H27F2N5O2.C2H6O/c1-3-14-13(8-25-7-12(9-26)6-18(19,20)11-25)4-5-15(23-14)17(21)16(10-27)24(2)22;1-3-2/h4-5,9,12,27H,3,6-8,10-11,21-22H2,1-2H3;1-2H3/b17-16-; |
| InChIKey | YOYDSVFPPNTYPG-XYJRJTJESA-N |
| XLogP | 0.99 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|