C26H39F2N7O4 — CID 162730323
methyl 2-[(3S)-1-[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-[(E)-4-imino-3-oxo-1-(propylamino)but-1-en-2-yl]oxyprop-1-enyl]-2-ethyl-3-pyridinyl]-5,5-difluoropiperidin-3-yl]acetate (PubChem CID 162730323) has the molecular formula C26H39F2N7O4 and a molecular weight of 551.64 g/mol. Its IUPAC name is methyl 2-[(3S)-1-[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-[(E)-4-imino-3-oxo-1-(propylamino)but-1-en-2-yl]oxyprop-1-enyl]-2-ethyl-3-pyridinyl]-5,5-difluoropiperidin-3-yl]acetate.
| Compound Name | methyl 2-[(3S)-1-[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-[(E)-4-imino-3-oxo-1-(propylamino)but-1-en-2-yl]oxyprop-1-enyl]-2-ethyl-3-pyridinyl]-5,5-difluoropiperidin-3-yl]acetate |
|---|---|
| PubChem CID | 162730323 |
| Molecular Formula | C26H39F2N7O4 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | methyl 2-[(3S)-1-[6-[(Z)-1-amino-2-[amino(methyl)amino]-3-[(E)-4-imino-3-oxo-1-(propylamino)but-1-en-2-yl]oxyprop-1-enyl]-2-ethyl-3-pyridinyl]-5,5-difluoropiperidin-3-yl]acetate |
| SMILES | [H]/N=C/C(=O)/C(=C\NCCC)OC/C(=C(/N)c1ccc(N2C[C@@H](CC(=O)OC)CC(F)(F)C2)c(CC)n1)N(C)N |
| InChI | InChI=1S/C26H39F2N7O4/c1-5-9-32-13-23(22(36)12-29)39-15-21(34(3)31)25(30)19-7-8-20(18(6-2)33-19)35-14-17(10-24(37)38-4)11-26(27,28)16-35/h7-8,12-13,17,29,32H,5-6,9-11,14-16,30-31H2,1-4H3/b23-13+,25-21-,29-12+/t17-/m0/s1 |
| InChIKey | VUAHMKIDWOJWRK-IMQRKDCOSA-N |
| XLogP | 2.18 |
| TPSA | 159.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|