C17H24N4O2 — CID 162730794
cis-(1S,3R)-3-[(2-cyano-1-hydroxyethyl)amino]-N-(4,5-dimethyl-2-pyridinyl)cyclohexane-1-carboxamide (PubChem CID 162730794) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is cis-(1S,3R)-3-[(2-cyano-1-hydroxyethyl)amino]-N-(4,5-dimethyl-2-pyridinyl)cyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3R)-3-[(2-cyano-1-hydroxyethyl)amino]-N-(4,5-dimethyl-2-pyridinyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 162730794 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | cis-(1S,3R)-3-[(2-cyano-1-hydroxyethyl)amino]-N-(4,5-dimethyl-2-pyridinyl)cyclohexane-1-carboxamide |
| SMILES | Cc1cnc(NC(=O)[C@H]2CCC[C@@H](NC(O)CC#N)C2)cc1C |
| InChI | InChI=1S/C17H24N4O2/c1-11-8-15(19-10-12(11)2)21-17(23)13-4-3-5-14(9-13)20-16(22)6-7-18/h8,10,13-14,16,20,22H,3-6,9H2,1-2H3,(H,19,21,23)/t13-,14+,16?/m0/s1 |
| InChIKey | ODJDYYGBNWTWDK-NNKZFNQJSA-N |
| XLogP | 2.02 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|