C17H20N2O2S — CID 162730887
N-[5-(dimethylaminosulfanyl)-2-methylphenyl]-2-(4-hydroxyphenyl)acetamide (PubChem CID 162730887) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[5-(dimethylaminosulfanyl)-2-methylphenyl]-2-(4-hydroxyphenyl)acetamide.
| Compound Name | N-[5-(dimethylaminosulfanyl)-2-methylphenyl]-2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 162730887 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[5-(dimethylaminosulfanyl)-2-methylphenyl]-2-(4-hydroxyphenyl)acetamide |
| SMILES | Cc1ccc(SN(C)C)cc1NC(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C17H20N2O2S/c1-12-4-9-15(22-19(2)3)11-16(12)18-17(21)10-13-5-7-14(20)8-6-13/h4-9,11,20H,10H2,1-3H3,(H,18,21) |
| InChIKey | DTCLBOAESSODQW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|