About 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline
4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline (PubChem CID 162731151) has the molecular formula C24H28F3NO
and a molecular weight of 403.49 g/mol. Its IUPAC name is 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline |
| PubChem CID | 162731151 |
| Molecular Formula | C24H28F3NO |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline |
| SMILES | CC1(C)CN(CC2CCOCC2)Cc2cc(-c3ccc(C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C24H28F3NO/c1-23(2)16-28(14-17-9-11-29-12-10-17)15-20-13-19(5-8-22(20)23)18-3-6-21(7-4-18)24(25,26)27/h3-8,13,17H,9-12,14-16H2,1-2H3 |
| InChIKey | XKVCXSURXRVOQJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline?
The IUPAC name of 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline (CID 162731151) is 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline.
What is the SMILES notation for 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline?
The canonical SMILES for 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline is CC1(C)CN(CC2CCOCC2)Cc2cc(-c3ccc(C(F)(F)F)cc3)ccc21.
What is the InChIKey of 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline?
The InChIKey is XKVCXSURXRVOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28F3NO/c1-23(2)16-28(14-17-9-11-29-12-10-17)15-20-13-19(5-8-22(20)23)18-3-6-21(7-4-18)24(25,26)27/h3-8,13,17H,9-12,14-16H2,1-2H3.
What are the key properties of 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline?
4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline has a molecular weight of 403.49 g/mol, XLogP of 5.89, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-(oxan-4-ylmethyl)-7-[4-(trifluoromethyl)phenyl]-1,3-dihydroisoquinoline is sourced from PubChem (CID 162731151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).