C22H28 — CID 162731376
7-but-1-en-2-yl-4-methyl-3-(3-methylcyclohepta-1,4,6-trien-1-yl)-3a,4,5,7a-tetrahydro-1H-indene (PubChem CID 162731376) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 7-but-1-en-2-yl-4-methyl-3-(3-methylcyclohepta-1,4,6-trien-1-yl)-3a,4,5,7a-tetrahydro-1H-indene.
| Compound Name | 7-but-1-en-2-yl-4-methyl-3-(3-methylcyclohepta-1,4,6-trien-1-yl)-3a,4,5,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 162731376 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 7-but-1-en-2-yl-4-methyl-3-(3-methylcyclohepta-1,4,6-trien-1-yl)-3a,4,5,7a-tetrahydro-1H-indene |
| SMILES | C=C(CC)C1=CCC(C)C2C(C3=CC(C)C=CC=C3)=CCC12 |
| InChI | InChI=1S/C22H28/c1-5-16(3)19-11-10-17(4)22-20(12-13-21(19)22)18-9-7-6-8-15(2)14-18/h6-9,11-12,14-15,17,21-22H,3,5,10,13H2,1-2,4H3 |
| InChIKey | QWXPYVTUMAVILS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |