About (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine
(Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine (PubChem CID 162731451) has the molecular formula C6H16N4O
and a molecular weight of 160.22 g/mol. Its IUPAC name is (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine |
| PubChem CID | 162731451 |
| Molecular Formula | C6H16N4O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine |
| SMILES | NC/C=C(/NCCN)OCN |
| InChI | InChI=1S/C6H16N4O/c7-2-1-6(11-5-9)10-4-3-8/h1,10H,2-5,7-9H2/b6-1- |
| InChIKey | HMMCRGWZHUVOSV-BHQIHCQQSA-N |
| XLogP | -1.73 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine?
The IUPAC name of (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine (CID 162731451) is (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine.
What is the SMILES notation for (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine?
The canonical SMILES for (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine is NC/C=C(/NCCN)OCN.
What is the InChIKey of (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine?
The InChIKey is HMMCRGWZHUVOSV-BHQIHCQQSA-N. The full InChI is InChI=1S/C6H16N4O/c7-2-1-6(11-5-9)10-4-3-8/h1,10H,2-5,7-9H2/b6-1-.
What are the key properties of (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine?
(Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine has a molecular weight of 160.22 g/mol, XLogP of -1.73, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(2-aminoethyl)-1-(aminomethoxy)prop-1-ene-1,3-diamine is sourced from PubChem (CID 162731451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).