About (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide
(3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide (PubChem CID 162732262) has the molecular formula C10H12F3NO
and a molecular weight of 219.21 g/mol. Its IUPAC name is (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide.
Molecular Properties
| Compound Name | (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide |
| PubChem CID | 162732262 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide |
| SMILES | C=C(/C=C\C(=C/C)C(F)(F)F)C(=O)NC |
| InChI | InChI=1S/C10H12F3NO/c1-4-8(10(11,12)13)6-5-7(2)9(15)14-3/h4-6H,2H2,1,3H3,(H,14,15)/b6-5-,8-4+ |
| InChIKey | MZTPAHMHWAOHML-QNMAEOQASA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide?
The IUPAC name of (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide (CID 162732262) is (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide.
What is the SMILES notation for (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide?
The canonical SMILES for (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide is C=C(/C=C\C(=C/C)C(F)(F)F)C(=O)NC.
What is the InChIKey of (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide?
The InChIKey is MZTPAHMHWAOHML-QNMAEOQASA-N. The full InChI is InChI=1S/C10H12F3NO/c1-4-8(10(11,12)13)6-5-7(2)9(15)14-3/h4-6H,2H2,1,3H3,(H,14,15)/b6-5-,8-4+.
What are the key properties of (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide?
(3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide has a molecular weight of 219.21 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-N-methyl-2-methylidene-5-(trifluoromethyl)hepta-3,5-dienamide is sourced from PubChem (CID 162732262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).