C45H18B10N4O — CID 162733250
CID 162733250 (PubChem CID 162733250) has the molecular formula C45H18B10N4O and a molecular weight of 738.79 g/mol.
| Compound Name | CID 162733250 |
|---|---|
| PubChem CID | 162733250 |
| Molecular Formula | C45H18B10N4O |
| Molecular Weight | 738.79 g/mol |
| Exact Mass | 740.24 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2nc(-c3c([B])c([B])c([B])c([B])c3[B])nc(-c3cccc4oc5ccc(-c6ccc7c(c6)c6ccccc6n7-c6ccccc6)cc5c34)n2)c([B])c1[B] |
| InChI | InChI=1S/C45H18B10N4O/c46-33-31(34(47)38(51)41(54)37(33)50)44-56-43(57-45(58-44)32-35(48)39(52)42(55)40(53)36(32)49)23-10-6-12-29-30(23)25-18-20(14-16-28(25)60-29)19-13-15-27-24(17-19)22-9-4-5-11-26(22)59(27)21-7-2-1-3-8-21/h1-18H |
| InChIKey | OEZIGRNRKQMHPX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.79 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|