C25H29N — CID 162735003
(E)-3-[3-[3-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-2-yl]phenyl]phenyl]prop-1-en-1-amine (PubChem CID 162735003) has the molecular formula C25H29N and a molecular weight of 343.51 g/mol. Its IUPAC name is (E)-3-[3-[3-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-2-yl]phenyl]phenyl]prop-1-en-1-amine.
| Compound Name | (E)-3-[3-[3-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-2-yl]phenyl]phenyl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 162735003 |
| Molecular Formula | C25H29N |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (E)-3-[3-[3-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-2-yl]phenyl]phenyl]prop-1-en-1-amine |
| SMILES | C=C(C)/C(=C\C=C(/C)c1cccc(-c2cccc(C/C=C/N)c2)c1)CC |
| InChI | InChI=1S/C25H29N/c1-5-22(19(2)3)15-14-20(4)23-11-7-13-25(18-23)24-12-6-9-21(17-24)10-8-16-26/h6-9,11-18H,2,5,10,26H2,1,3-4H3/b16-8+,20-14+,22-15- |
| InChIKey | NSQSKFQHJQYPSA-WOHBTGFVSA-N |
| XLogP | 6.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|