C20H29FN4O3 — CID 162735064
methyl (2R,3S,5R)-3-amino-2-[[(1S,3R,6S,7R)-6-(5-fluoropyrimidin-2-yl)-7-methyl-3-bicyclo[4.1.0]heptanyl]oxymethyl]-5-methylpyrrolidine-1-carboxylate (PubChem CID 162735064) has the molecular formula C20H29FN4O3 and a molecular weight of 392.48 g/mol. Its IUPAC name is methyl (2R,3S,5R)-3-amino-2-[[(1S,3R,6S,7R)-6-(5-fluoropyrimidin-2-yl)-7-methyl-3-bicyclo[4.1.0]heptanyl]oxymethyl]-5-methylpyrrolidine-1-carboxylate.
| Compound Name | methyl (2R,3S,5R)-3-amino-2-[[(1S,3R,6S,7R)-6-(5-fluoropyrimidin-2-yl)-7-methyl-3-bicyclo[4.1.0]heptanyl]oxymethyl]-5-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162735064 |
| Molecular Formula | C20H29FN4O3 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | methyl (2R,3S,5R)-3-amino-2-[[(1S,3R,6S,7R)-6-(5-fluoropyrimidin-2-yl)-7-methyl-3-bicyclo[4.1.0]heptanyl]oxymethyl]-5-methylpyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1[C@H](C)C[C@H](N)[C@@H]1CO[C@@H]1CC[C@]2(c3ncc(F)cn3)[C@H](C)[C@@H]2C1 |
| InChI | InChI=1S/C20H29FN4O3/c1-11-6-16(22)17(25(11)19(26)27-3)10-28-14-4-5-20(12(2)15(20)7-14)18-23-8-13(21)9-24-18/h8-9,11-12,14-17H,4-7,10,22H2,1-3H3/t11-,12-,14-,15+,16+,17+,20+/m1/s1 |
| InChIKey | ZBQVDFWPOLVVKI-IZIVCHGQSA-N |
| XLogP | 2.24 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |