About (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride
(3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride (PubChem CID 162735079) has the molecular formula C12H16F2N2O
and a molecular weight of 242.27 g/mol. Its IUPAC name is (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride.
Molecular Properties
| Compound Name | (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride |
| PubChem CID | 162735079 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride |
| SMILES | Cc1nc([C@@]23CC[C@H](O)CC2C3)ncc1F.F |
| InChI | InChI=1S/C12H15FN2O.FH/c1-7-10(13)6-14-11(15-7)12-3-2-9(16)4-8(12)5-12;/h6,8-9,16H,2-5H2,1H3;1H/t8?,9-,12+;/m0./s1 |
| InChIKey | TZGBAEMOWHDTBX-ILHDGHCVSA-N |
| XLogP | 1.88 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride?
The IUPAC name of (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride (CID 162735079) is (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride.
What is the SMILES notation for (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride?
The canonical SMILES for (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride is Cc1nc([C@@]23CC[C@H](O)CC2C3)ncc1F.F.
What is the InChIKey of (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride?
The InChIKey is TZGBAEMOWHDTBX-ILHDGHCVSA-N. The full InChI is InChI=1S/C12H15FN2O.FH/c1-7-10(13)6-14-11(15-7)12-3-2-9(16)4-8(12)5-12;/h6,8-9,16H,2-5H2,1H3;1H/t8?,9-,12+;/m0./s1.
What are the key properties of (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride?
(3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride has a molecular weight of 242.27 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,6R)-6-(5-fluoro-4-methylpyrimidin-2-yl)bicyclo[4.1.0]heptan-3-ol;hydrofluoride is sourced from PubChem (CID 162735079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).