C20H31FN4O3 — CID 162735141
[(2R,3S,5R)-3-amino-2-[[(1R,3S,6R,7S)-6-(5-fluoropyrimidin-2-yl)-7-methyl-3-bicyclo[4.1.0]heptanyl]oxymethyl]-5-methylpyrrolidin-1-yl]-methoxymethanol (PubChem CID 162735141) has the molecular formula C20H31FN4O3 and a molecular weight of 394.49 g/mol. Its IUPAC name is [(2R,3S,5R)-3-amino-2-[[(1R,3S,6R,7S)-6-(5-fluoropyrimidin-2-yl)-7-methyl-3-bicyclo[4.1.0]heptanyl]oxymethyl]-5-methylpyrrolidin-1-yl]-methoxymethanol.
| Compound Name | [(2R,3S,5R)-3-amino-2-[[(1R,3S,6R,7S)-6-(5-fluoropyrimidin-2-yl)-7-methyl-3-bicyclo[4.1.0]heptanyl]oxymethyl]-5-methylpyrrolidin-1-yl]-methoxymethanol |
|---|---|
| PubChem CID | 162735141 |
| Molecular Formula | C20H31FN4O3 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | [(2R,3S,5R)-3-amino-2-[[(1R,3S,6R,7S)-6-(5-fluoropyrimidin-2-yl)-7-methyl-3-bicyclo[4.1.0]heptanyl]oxymethyl]-5-methylpyrrolidin-1-yl]-methoxymethanol |
| SMILES | COC(O)N1[C@H](C)C[C@H](N)[C@@H]1CO[C@H]1CC[C@]2(c3ncc(F)cn3)[C@H](C1)[C@@H]2C |
| InChI | InChI=1S/C20H31FN4O3/c1-11-6-16(22)17(25(11)19(26)27-3)10-28-14-4-5-20(12(2)15(20)7-14)18-23-8-13(21)9-24-18/h8-9,11-12,14-17,19,26H,4-7,10,22H2,1-3H3/t11-,12+,14+,15-,16+,17+,19?,20-/m1/s1 |
| InChIKey | AONUGWQGMWBTFR-AXBOWFNNSA-N |
| XLogP | 1.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|