C22H21Cl3N4O2 — CID 162735353
5-chloro-N-[(2,5-dichlorophenyl)methyl]-3-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]imidazo[4,5-b]pyridin-7-amine (PubChem CID 162735353) has the molecular formula C22H21Cl3N4O2 and a molecular weight of 479.80 g/mol. Its IUPAC name is 5-chloro-N-[(2,5-dichlorophenyl)methyl]-3-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-N-[(2,5-dichlorophenyl)methyl]-3-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 162735353 |
| Molecular Formula | C22H21Cl3N4O2 |
| Molecular Weight | 479.80 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 5-chloro-N-[(2,5-dichlorophenyl)methyl]-3-[(1R,2R,4S,5R,6S)-8,8-dimethyl-7,9-dioxatricyclo[4.3.0.02,4]nonan-5-yl]imidazo[4,5-b]pyridin-7-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H]3C[C@@H]3[C@@H](n3cnc4c(NCc5cc(Cl)ccc5Cl)cc(Cl)nc43)[C@@H]2O1 |
| InChI | InChI=1S/C22H21Cl3N4O2/c1-22(2)30-19-13-6-12(13)18(20(19)31-22)29-9-27-17-15(7-16(25)28-21(17)29)26-8-10-5-11(23)3-4-14(10)24/h3-5,7,9,12-13,18-20H,6,8H2,1-2H3,(H,26,28)/t12-,13+,18+,19+,20-/m0/s1 |
| InChIKey | JSOSKQIDQKRMDI-YCQOOCDKSA-N |
| XLogP | 5.71 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.80 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|